C28H27F4N3O5 — CID 164915258
5-[(2R)-1-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915258) has the molecular formula C28H27F4N3O5 and a molecular weight of 561.53 g/mol. Its IUPAC name is 5-[(2R)-1-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[(2R)-1-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915258 |
| Molecular Formula | C28H27F4N3O5 |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 5-[(2R)-1-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | C[C@H](COCCCCNCc1ccc(OC(F)(F)F)c(F)c1)Oc1nc2cc(C(=O)O)ccc2c2cnccc12 |
| InChI | InChI=1S/C28H27F4N3O5/c1-17(16-38-11-3-2-9-33-14-18-4-7-25(23(29)12-18)40-28(30,31)32)39-26-21-8-10-34-15-22(21)20-6-5-19(27(36)37)13-24(20)35-26/h4-8,10,12-13,15,17,33H,2-3,9,11,14,16H2,1H3,(H,36,37)/t17-/m1/s1 |
| InChIKey | GYIWPHYGXVVJQR-QGZVFWFLSA-N |
| XLogP | 5.87 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|