C28H30F3N5O3 — CID 164915262
5-[2-[4-[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915262) has the molecular formula C28H30F3N5O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is 5-[2-[4-[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915262 |
| Molecular Formula | C28H30F3N5O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 5-[2-[4-[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1cc(CO)cc(C(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C28H30F3N5O3/c29-28(30,31)21-12-18(11-19(13-21)17-37)15-33-6-1-2-9-39-10-8-35-27-23-5-7-34-16-24(23)22-4-3-20(26(32)38)14-25(22)36-27/h3-5,7,11-14,16,33,37H,1-2,6,8-10,15,17H2,(H2,32,38)(H,35,36) |
| InChIKey | PSQFBYYCAIHWKL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|