C29H30F3N5O5 — CID 164915265
5-[2-[4-[[3-(2-amino-2-oxoethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915265) has the molecular formula C29H30F3N5O5 and a molecular weight of 585.58 g/mol. Its IUPAC name is 5-[2-[4-[[3-(2-amino-2-oxoethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(2-amino-2-oxoethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915265 |
| Molecular Formula | C29H30F3N5O5 |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 5-[2-[4-[[3-(2-amino-2-oxoethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)Cc1cc(CNCCCCOCCOc2nc3cc(C(N)=O)ccc3c3cnccc23)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F3N5O5/c30-29(31,32)42-21-12-18(14-26(33)38)11-19(13-21)16-35-6-1-2-8-40-9-10-41-28-23-5-7-36-17-24(23)22-4-3-20(27(34)39)15-25(22)37-28/h3-5,7,11-13,15,17,35H,1-2,6,8-10,14,16H2,(H2,33,38)(H2,34,39) |
| InChIKey | SDKSLRSDCNLLCJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|