C30H33ClN4O4 — CID 164915274
5-[2-[4-[(3-chloro-4-cyclobutyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915274) has the molecular formula C30H33ClN4O4 and a molecular weight of 549.07 g/mol. Its IUPAC name is 5-[2-[4-[(3-chloro-4-cyclobutyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[(3-chloro-4-cyclobutyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915274 |
| Molecular Formula | C30H33ClN4O4 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 5-[2-[4-[(3-chloro-4-cyclobutyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NCCOCCCCNCc1ccc(OC3CCC3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C30H33ClN4O4/c31-26-16-20(6-9-28(26)39-22-4-3-5-22)18-32-11-1-2-14-38-15-13-34-29-24-10-12-33-19-25(24)23-8-7-21(30(36)37)17-27(23)35-29/h6-10,12,16-17,19,22,32H,1-5,11,13-15,18H2,(H,34,35)(H,36,37) |
| InChIKey | XBOHQXULVSSBPU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|