C27H26F4N4O4 — CID 164915279
5-[2-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915279) has the molecular formula C27H26F4N4O4 and a molecular weight of 546.52 g/mol. Its IUPAC name is 5-[2-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915279 |
| Molecular Formula | C27H26F4N4O4 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 5-[2-[4-[[3-fluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(OCCOCCCCNCc1ccc(OC(F)(F)F)c(F)c1)c1ccncc12 |
| InChI | InChI=1S/C27H26F4N4O4/c28-22-13-17(3-6-24(22)39-27(29,30)31)15-33-8-1-2-10-37-11-12-38-26-20-7-9-34-16-21(20)19-5-4-18(25(32)36)14-23(19)35-26/h3-7,9,13-14,16,33H,1-2,8,10-12,15H2,(H2,32,36) |
| InChIKey | DTWCVKKTOYUKED-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|