About [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone
[2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone (PubChem CID 164915470) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone.
Molecular Properties
| Compound Name | [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone |
| PubChem CID | 164915470 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone |
| SMILES | CC(C)=NOc1ccccc1C(=O)c1cccc(C)c1C1OCCO1 |
| InChI | InChI=1S/C20H21NO4/c1-13(2)21-25-17-10-5-4-8-15(17)19(22)16-9-6-7-14(3)18(16)20-23-11-12-24-20/h4-10,20H,11-12H2,1-3H3 |
| InChIKey | PVHVOZGAAAIJDT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone?
The IUPAC name of [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone (CID 164915470) is [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone.
What is the SMILES notation for [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone?
The canonical SMILES for [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone is CC(C)=NOc1ccccc1C(=O)c1cccc(C)c1C1OCCO1.
What is the InChIKey of [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone?
The InChIKey is PVHVOZGAAAIJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4/c1-13(2)21-25-17-10-5-4-8-15(17)19(22)16-9-6-7-14(3)18(16)20-23-11-12-24-20/h4-10,20H,11-12H2,1-3H3.
What are the key properties of [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone?
[2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone has a molecular weight of 339.39 g/mol, XLogP of 4.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxolan-2-yl)-3-methylphenyl]-[2-(propan-2-ylideneamino)oxyphenyl]methanone is sourced from PubChem (CID 164915470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).