About 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile
5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile (PubChem CID 164915848) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile |
| PubChem CID | 164915848 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile |
| SMILES | CC1=C(C)N=C(C#N)CC1 |
| InChI | InChI=1S/C8H10N2/c1-6-3-4-8(5-9)10-7(6)2/h3-4H2,1-2H3 |
| InChIKey | XAKUNTIVLLUBCH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile?
The IUPAC name of 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile (CID 164915848) is 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile.
What is the SMILES notation for 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile?
The canonical SMILES for 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile is CC1=C(C)N=C(C#N)CC1.
What is the InChIKey of 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile?
The InChIKey is XAKUNTIVLLUBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-3-4-8(5-9)10-7(6)2/h3-4H2,1-2H3.
What are the key properties of 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile?
5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile has a molecular weight of 134.18 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3,4-dihydropyridine-2-carbonitrile is sourced from PubChem (CID 164915848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).