About (6-methyl-3-pyridinyl) hypochlorite
(6-methyl-3-pyridinyl) hypochlorite (PubChem CID 164916594) has the molecular formula C6H6ClNO
and a molecular weight of 143.57 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) hypochlorite.
Molecular Properties
| Compound Name | (6-methyl-3-pyridinyl) hypochlorite |
| PubChem CID | 164916594 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 g/mol |
| Exact Mass | 143.01 |
| IUPAC Name | (6-methyl-3-pyridinyl) hypochlorite |
| SMILES | Cc1ccc(OCl)cn1 |
| InChI | InChI=1S/C6H6ClNO/c1-5-2-3-6(9-7)4-8-5/h2-4H,1H3 |
| InChIKey | WFZPTRASAMZJEH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-methyl-3-pyridinyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3-pyridinyl) hypochlorite?
The IUPAC name of (6-methyl-3-pyridinyl) hypochlorite (CID 164916594) is (6-methyl-3-pyridinyl) hypochlorite.
What is the SMILES notation for (6-methyl-3-pyridinyl) hypochlorite?
The canonical SMILES for (6-methyl-3-pyridinyl) hypochlorite is Cc1ccc(OCl)cn1.
What is the InChIKey of (6-methyl-3-pyridinyl) hypochlorite?
The InChIKey is WFZPTRASAMZJEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO/c1-5-2-3-6(9-7)4-8-5/h2-4H,1H3.
What are the key properties of (6-methyl-3-pyridinyl) hypochlorite?
(6-methyl-3-pyridinyl) hypochlorite has a molecular weight of 143.57 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3-pyridinyl) hypochlorite is sourced from PubChem (CID 164916594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).