C32H38N4O — CID 164916952
4-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butylamino]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 164916952) has the molecular formula C32H38N4O and a molecular weight of 494.68 g/mol. Its IUPAC name is 4-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butylamino]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | 4-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butylamino]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 164916952 |
| Molecular Formula | C32H38N4O |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 4-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butylamino]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CCNCCCCN1CCc2ccc(C#N)cc2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N4O/c1-35(2)31(37)32(29-11-5-3-6-12-29,30-13-7-4-8-14-30)18-20-34-19-9-10-21-36-22-17-27-16-15-26(24-33)23-28(27)25-36/h3-8,11-16,23,34H,9-10,17-22,25H2,1-2H3 |
| InChIKey | TYNGMNWXSRTYJA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|