About 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide
4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 164916990) has the molecular formula C30H36ClN3O
and a molecular weight of 490.09 g/mol. Its IUPAC name is 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
Molecular Properties
| Compound Name | 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| PubChem CID | 164916990 |
| Molecular Formula | C30H36ClN3O |
| Molecular Weight | 490.09 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CCc1cccc(N2CCN(CCC(C(=O)N(C)C)(c3ccccc3)c3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C30H36ClN3O/c1-4-24-12-11-17-27(28(24)31)34-22-20-33(21-23-34)19-18-30(29(35)32(2)3,25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-17H,4,18-23H2,1-3H3 |
| InChIKey | VJKSHVBEJFBNJR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.09 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide?
The IUPAC name of 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide (CID 164916990) is 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
What is the SMILES notation for 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide?
The canonical SMILES for 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide is CCc1cccc(N2CCN(CCC(C(=O)N(C)C)(c3ccccc3)c3ccccc3)CC2)c1Cl.
What is the InChIKey of 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide?
The InChIKey is VJKSHVBEJFBNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36ClN3O/c1-4-24-12-11-17-27(28(24)31)34-22-20-33(21-23-34)19-18-30(29(35)32(2)3,25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-17H,4,18-23H2,1-3H3.
What are the key properties of 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide?
4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide has a molecular weight of 490.09 g/mol, XLogP of 5.49, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide is sourced from PubChem (CID 164916990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).