C22H20F3N5O2 — CID 164917043
11-[(3S)-oxolan-3-yl]-8-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9-pentaen-12-one (PubChem CID 164917043) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is 11-[(3S)-oxolan-3-yl]-8-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9-pentaen-12-one.
| Compound Name | 11-[(3S)-oxolan-3-yl]-8-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9-pentaen-12-one |
|---|---|
| PubChem CID | 164917043 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 11-[(3S)-oxolan-3-yl]-8-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9-pentaen-12-one |
| SMILES | C[C@@H](Nc1nc2ccnn2c2cc(=O)n([C@H]3CCOC3)cc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N5O2/c1-13(14-3-2-4-15(9-14)22(23,24)25)27-21-17-11-29(16-6-8-32-12-16)20(31)10-18(17)30-19(28-21)5-7-26-30/h2-5,7,9-11,13,16H,6,8,12H2,1H3,(H,27,28)/t13-,16+/m1/s1 |
| InChIKey | DXLFMJBKOVGLRO-CJNGLKHVSA-N |
| XLogP | 4.20 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |