About (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine
(E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine (PubChem CID 164917234) has the molecular formula C6H5BrF3N
and a molecular weight of 228.01 g/mol. Its IUPAC name is (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine.
Molecular Properties
| Compound Name | (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine |
| PubChem CID | 164917234 |
| Molecular Formula | C6H5BrF3N |
| Molecular Weight | 228.01 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine |
| SMILES | C=C/C(=N\C(=C)Br)C(F)(F)F |
| InChI | InChI=1S/C6H5BrF3N/c1-3-5(6(8,9)10)11-4(2)7/h3H,1-2H2/b11-5+ |
| InChIKey | JICIRBODKXKHKD-VZUCSPMQSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.01 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine?
The IUPAC name of (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine (CID 164917234) is (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine.
What is the SMILES notation for (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine?
The canonical SMILES for (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine is C=C/C(=N\C(=C)Br)C(F)(F)F.
What is the InChIKey of (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine?
The InChIKey is JICIRBODKXKHKD-VZUCSPMQSA-N. The full InChI is InChI=1S/C6H5BrF3N/c1-3-5(6(8,9)10)11-4(2)7/h3H,1-2H2/b11-5+.
What are the key properties of (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine?
(E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine has a molecular weight of 228.01 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(1-bromoethenyl)-1,1,1-trifluorobut-3-en-2-imine is sourced from PubChem (CID 164917234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).