About [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen
[4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen (PubChem CID 164917553) has the molecular formula C14H16N4O
and a molecular weight of 256.31 g/mol. Its IUPAC name is [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen.
Molecular Properties
| Compound Name | [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen |
| PubChem CID | 164917553 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen |
| SMILES | OCc1ccc(-c2ccc(C3=NNNN3)cc2)cc1.[H][H] |
| InChI | InChI=1S/C14H14N4O.H2/c19-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)14-15-17-18-16-14;/h1-8,17-19H,9H2,(H,15,16);1H |
| InChIKey | PSOKAZQZKFZRRF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen?
The IUPAC name of [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen (CID 164917553) is [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen.
What is the SMILES notation for [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen?
The canonical SMILES for [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen is OCc1ccc(-c2ccc(C3=NNNN3)cc2)cc1.[H][H].
What is the InChIKey of [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen?
The InChIKey is PSOKAZQZKFZRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O.H2/c19-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)14-15-17-18-16-14;/h1-8,17-19H,9H2,(H,15,16);1H.
What are the key properties of [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen?
[4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen has a molecular weight of 256.31 g/mol, XLogP of 1.37, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methanol;molecular hydrogen is sourced from PubChem (CID 164917553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).