C13H15BN4O5S2 — CID 164917899
3-[2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-2-boronoethyl]benzoic acid (PubChem CID 164917899) has the molecular formula C13H15BN4O5S2 and a molecular weight of 382.23 g/mol. Its IUPAC name is 3-[2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-2-boronoethyl]benzoic acid.
| Compound Name | 3-[2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-2-boronoethyl]benzoic acid |
|---|---|
| PubChem CID | 164917899 |
| Molecular Formula | C13H15BN4O5S2 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-[2-[[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-2-boronoethyl]benzoic acid |
| SMILES | Nc1nnc(SCC(=O)NC(Cc2cccc(C(=O)O)c2)B(O)O)s1 |
| InChI | InChI=1S/C13H15BN4O5S2/c15-12-17-18-13(25-12)24-6-10(19)16-9(14(22)23)5-7-2-1-3-8(4-7)11(20)21/h1-4,9,22-23H,5-6H2,(H2,15,17)(H,16,19)(H,20,21) |
| InChIKey | UJPIMGFDOWJTBS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|