About ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide
ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide (PubChem CID 164918002) has the molecular formula C5H11N3O3
and a molecular weight of 161.16 g/mol. Its IUPAC name is ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
| PubChem CID | 164918002 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CC.NC(=O)c1noc(=O)[nH]1.[H][H] |
| InChI | InChI=1S/C3H3N3O3.C2H6.H2/c4-1(7)2-5-3(8)9-6-2;1-2;/h(H2,4,7)(H,5,6,8);1-2H3;1H |
| InChIKey | VXTYGPSEBIKEBR-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide?
The IUPAC name of ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide (CID 164918002) is ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide.
What is the SMILES notation for ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide?
The canonical SMILES for ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide is CC.NC(=O)c1noc(=O)[nH]1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide?
The InChIKey is VXTYGPSEBIKEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O3.C2H6.H2/c4-1(7)2-5-3(8)9-6-2;1-2;/h(H2,4,7)(H,5,6,8);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide?
ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide has a molecular weight of 161.16 g/mol, XLogP of -0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;5-oxo-4H-1,2,4-oxadiazole-3-carboxamide is sourced from PubChem (CID 164918002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).