C23H24CmF3N4O3S- — CID 164918509
curium;N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-(1,1-dioxo-2,3,5,6-tetrahydrothiopyran-4-id-4-yl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 164918509) has the molecular formula C23H24CmF3N4O3S- and a molecular weight of 740.53 g/mol. Its IUPAC name is curium;N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-(1,1-dioxo-2,3,5,6-tetrahydrothiopyran-4-id-4-yl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | curium;N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-(1,1-dioxo-2,3,5,6-tetrahydrothiopyran-4-id-4-yl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164918509 |
| Molecular Formula | C23H24CmF3N4O3S- |
| Molecular Weight | 740.53 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | curium;N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-(1,1-dioxo-2,3,5,6-tetrahydrothiopyran-4-id-4-yl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COc1nc2nc(C)nc(N[C@H](C)c3cccc(C(F)F)c3F)c2cc1[C-]1CCS(=O)(=O)CC1.[Cm] |
| InChI | InChI=1S/C23H24F3N4O3S.Cm/c1-12(15-5-4-6-16(19(15)24)20(25)26)27-21-18-11-17(14-7-9-34(31,32)10-8-14)23(33-3)30-22(18)29-13(2)28-21;/h4-6,11-12,20H,7-10H2,1-3H3,(H,27,28,29,30);/q-1;/t12-;/m1./s1 |
| InChIKey | FLNHCWMGOMYYLA-UTONKHPSSA-N |
| XLogP | 4.72 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|