C21H22F3IN6O — CID 164918822
N-[(R)-[3-(difluoromethyl)-2-fluorophenyl]-iodomethyl]-7-methoxy-6-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 164918822) has the molecular formula C21H22F3IN6O and a molecular weight of 558.35 g/mol. Its IUPAC name is N-[(R)-[3-(difluoromethyl)-2-fluorophenyl]-iodomethyl]-7-methoxy-6-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(R)-[3-(difluoromethyl)-2-fluorophenyl]-iodomethyl]-7-methoxy-6-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164918822 |
| Molecular Formula | C21H22F3IN6O |
| Molecular Weight | 558.35 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | N-[(R)-[3-(difluoromethyl)-2-fluorophenyl]-iodomethyl]-7-methoxy-6-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COc1nc2ncnc(N[C@H](I)c3cccc(C(F)F)c3F)c2cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C21H22F3IN6O/c1-30-6-8-31(9-7-30)15-10-14-19(26-11-27-20(14)29-21(15)32-2)28-18(25)13-5-3-4-12(16(13)22)17(23)24/h3-5,10-11,17-18H,6-9H2,1-2H3,(H,26,27,28,29)/t18-/m0/s1 |
| InChIKey | RMFMVRPFLSPZQC-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|