About (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane
(2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane (PubChem CID 164918881) has the molecular formula C12H17F3O
and a molecular weight of 234.26 g/mol. Its IUPAC name is (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane.
Molecular Properties
| Compound Name | (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane |
| PubChem CID | 164918881 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane |
| SMILES | CC.Cc1cccc(C(F)(F)[C@@H](C)O)c1F |
| InChI | InChI=1S/C10H11F3O.C2H6/c1-6-4-3-5-8(9(6)11)10(12,13)7(2)14;1-2/h3-5,7,14H,1-2H3;1-2H3/t7-;/m1./s1 |
| InChIKey | BTMPOEQVVUGYSZ-OGFXRTJISA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane?
The IUPAC name of (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane (CID 164918881) is (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane.
What is the SMILES notation for (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane?
The canonical SMILES for (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane is CC.Cc1cccc(C(F)(F)[C@@H](C)O)c1F.
What is the InChIKey of (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane?
The InChIKey is BTMPOEQVVUGYSZ-OGFXRTJISA-N. The full InChI is InChI=1S/C10H11F3O.C2H6/c1-6-4-3-5-8(9(6)11)10(12,13)7(2)14;1-2/h3-5,7,14H,1-2H3;1-2H3/t7-;/m1./s1.
What are the key properties of (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane?
(2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane has a molecular weight of 234.26 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-difluoro-1-(2-fluoro-3-methylphenyl)propan-2-ol;ethane is sourced from PubChem (CID 164918881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).