About 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene
2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene (PubChem CID 164919193) has the molecular formula C24H25NS
and a molecular weight of 359.54 g/mol. Its IUPAC name is 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene.
Molecular Properties
| Compound Name | 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene |
| PubChem CID | 164919193 |
| Molecular Formula | C24H25NS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene |
| SMILES | C=C(CC)c1cc2cccc(N)c2s1.CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H13NS.C12H12/c1-3-8(2)11-7-9-5-4-6-10(13)12(9)14-11;1-2-10-7-8-11-5-3-4-6-12(11)9-10/h4-7H,2-3,13H2,1H3;3-9H,2H2,1H3 |
| InChIKey | JJRYNCVKBTXUEZ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene?
The IUPAC name of 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene (CID 164919193) is 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene.
What is the SMILES notation for 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene?
The canonical SMILES for 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene is C=C(CC)c1cc2cccc(N)c2s1.CCc1ccc2ccccc2c1.
What is the InChIKey of 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene?
The InChIKey is JJRYNCVKBTXUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS.C12H12/c1-3-8(2)11-7-9-5-4-6-10(13)12(9)14-11;1-2-10-7-8-11-5-3-4-6-12(11)9-10/h4-7H,2-3,13H2,1H3;3-9H,2H2,1H3.
What are the key properties of 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene?
2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene has a molecular weight of 359.54 g/mol, XLogP of 7.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-en-2-yl-1-benzothiophen-7-amine;2-ethylnaphthalene is sourced from PubChem (CID 164919193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).