C24H26ClFN8O2 — CID 164920371
4-[[(1Z)-1-[3-chloro-4-[1-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]-3-methylpiperidine-1-carbonitrile (PubChem CID 164920371) has the molecular formula C24H26ClFN8O2 and a molecular weight of 512.98 g/mol. Its IUPAC name is 4-[[(1Z)-1-[3-chloro-4-[1-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]-3-methylpiperidine-1-carbonitrile.
| Compound Name | 4-[[(1Z)-1-[3-chloro-4-[1-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]-3-methylpiperidine-1-carbonitrile |
|---|---|
| PubChem CID | 164920371 |
| Molecular Formula | C24H26ClFN8O2 |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-[[(1Z)-1-[3-chloro-4-[1-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]-3-methylpiperidine-1-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1C)/C(=N\N)c1cc(OC(CO)c2ccc(F)cn2)c2c(Cl)cnn2c1 |
| InChI | InChI=1S/C24H26ClFN8O2/c1-14-10-33(13-27)6-5-19(14)31-15(2)23(32-28)16-7-21(24-18(25)9-30-34(24)11-16)36-22(12-35)20-4-3-17(26)8-29-20/h3-4,7-9,11,14,19,22,35H,5-6,10,12,28H2,1-2H3/b31-15+,32-23+ |
| InChIKey | AQOHJLSSCOAQSF-WQZMNTFSSA-N |
| XLogP | 2.95 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|