About 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane
5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane (PubChem CID 164920429) has the molecular formula C10H12Cl2N2
and a molecular weight of 231.13 g/mol. Its IUPAC name is 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane.
Molecular Properties
| Compound Name | 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane |
| PubChem CID | 164920429 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane |
| SMILES | CC.Cc1cnc2cc(Cl)cc(Cl)n12 |
| InChI | InChI=1S/C8H6Cl2N2.C2H6/c1-5-4-11-8-3-6(9)2-7(10)12(5)8;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | WXLJCDKKEYKNMZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane?
The IUPAC name of 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane (CID 164920429) is 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane.
What is the SMILES notation for 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane?
The canonical SMILES for 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane is CC.Cc1cnc2cc(Cl)cc(Cl)n12.
What is the InChIKey of 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane?
The InChIKey is WXLJCDKKEYKNMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2.C2H6/c1-5-4-11-8-3-6(9)2-7(10)12(5)8;1-2/h2-4H,1H3;1-2H3.
What are the key properties of 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane?
5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane has a molecular weight of 231.13 g/mol, XLogP of 3.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-methylimidazo[1,2-a]pyridine;ethane is sourced from PubChem (CID 164920429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).