C21H24ClFN7O2+ — CID 164920468
2-[[6-[2-(3-aminocyclobutyl)iminopropanehydrazonoyl]-3-chloro-1H-pyrazolo[1,5-a]pyridin-8-ium-4-yl]oxy]-2-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 164920468) has the molecular formula C21H24ClFN7O2+ and a molecular weight of 460.92 g/mol. Its IUPAC name is 2-[[6-[2-(3-aminocyclobutyl)iminopropanehydrazonoyl]-3-chloro-1H-pyrazolo[1,5-a]pyridin-8-ium-4-yl]oxy]-2-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | 2-[[6-[2-(3-aminocyclobutyl)iminopropanehydrazonoyl]-3-chloro-1H-pyrazolo[1,5-a]pyridin-8-ium-4-yl]oxy]-2-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 164920468 |
| Molecular Formula | C21H24ClFN7O2+ |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[[6-[2-(3-aminocyclobutyl)iminopropanehydrazonoyl]-3-chloro-1H-pyrazolo[1,5-a]pyridin-8-ium-4-yl]oxy]-2-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | CC(=N\C1CC(N)C1)/C(=N\N)c1cc(OC(CO)c2ccc(F)cn2)c2c(Cl)c[nH][n+]2c1 |
| InChI | InChI=1S/C21H23ClFN7O2/c1-11(28-15-5-14(24)6-15)20(29-25)12-4-18(21-16(22)8-27-30(21)9-12)32-19(10-31)17-3-2-13(23)7-26-17/h2-4,7-9,14-15,19,31H,5-6,10,24H2,1H3,(H2,25,28)/p+1 |
| InChIKey | WQHCFTMLZHILAA-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|