C29H35F3N8O4 — CID 164920956
7-[2-(1-tert-butylpiperidin-4-yl)iminopropanehydrazonoyl]-5-[1-[5-(trifluoromethoxy)-3-pyridinyl]ethoxy]imidazo[1,2-a]pyridine-3-carbonitrile;formic acid (PubChem CID 164920956) has the molecular formula C29H35F3N8O4 and a molecular weight of 616.65 g/mol. Its IUPAC name is 7-[2-(1-tert-butylpiperidin-4-yl)iminopropanehydrazonoyl]-5-[1-[5-(trifluoromethoxy)-3-pyridinyl]ethoxy]imidazo[1,2-a]pyridine-3-carbonitrile;formic acid.
| Compound Name | 7-[2-(1-tert-butylpiperidin-4-yl)iminopropanehydrazonoyl]-5-[1-[5-(trifluoromethoxy)-3-pyridinyl]ethoxy]imidazo[1,2-a]pyridine-3-carbonitrile;formic acid |
|---|---|
| PubChem CID | 164920956 |
| Molecular Formula | C29H35F3N8O4 |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 7-[2-(1-tert-butylpiperidin-4-yl)iminopropanehydrazonoyl]-5-[1-[5-(trifluoromethoxy)-3-pyridinyl]ethoxy]imidazo[1,2-a]pyridine-3-carbonitrile;formic acid |
| SMILES | CC(=N\C1CCN(C(C)(C)C)CC1)/C(=N\N)c1cc(OC(C)c2cncc(OC(F)(F)F)c2)n2c(C#N)cnc2c1.O=CO |
| InChI | InChI=1S/C28H33F3N8O2.CH2O2/c1-17(36-21-6-8-38(9-7-21)27(3,4)5)26(37-33)19-11-24-35-15-22(13-32)39(24)25(12-19)40-18(2)20-10-23(16-34-14-20)41-28(29,30)31;2-1-3/h10-12,14-16,18,21H,6-9,33H2,1-5H3;1H,(H,2,3)/b36-17+,37-26+; |
| InChIKey | HAGVJAVKRJNZFH-JOGBYOGZSA-N |
| XLogP | 4.73 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|