C16H21FN4O — CID 164921669
6-fluoro-2-(oxan-4-yl)-7-piperidin-4-yl-1H-imidazo[4,5-b]pyridine (PubChem CID 164921669) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is 6-fluoro-2-(oxan-4-yl)-7-piperidin-4-yl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-fluoro-2-(oxan-4-yl)-7-piperidin-4-yl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 164921669 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 6-fluoro-2-(oxan-4-yl)-7-piperidin-4-yl-1H-imidazo[4,5-b]pyridine |
| SMILES | Fc1cnc2nc(C3CCOCC3)[nH]c2c1C1CCNCC1 |
| InChI | InChI=1S/C16H21FN4O/c17-12-9-19-16-14(13(12)10-1-5-18-6-2-10)20-15(21-16)11-3-7-22-8-4-11/h9-11,18H,1-8H2,(H,19,20,21) |
| InChIKey | RTGMPGDCZMAOMW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |