C23H28N6O2 — CID 164921742
(2-amino-4-methylphenyl)-[4-(2-morpholin-2-yl-1H-imidazo[4,5-b]pyridin-7-yl)piperidin-1-yl]methanone (PubChem CID 164921742) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is (2-amino-4-methylphenyl)-[4-(2-morpholin-2-yl-1H-imidazo[4,5-b]pyridin-7-yl)piperidin-1-yl]methanone.
| Compound Name | (2-amino-4-methylphenyl)-[4-(2-morpholin-2-yl-1H-imidazo[4,5-b]pyridin-7-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164921742 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (2-amino-4-methylphenyl)-[4-(2-morpholin-2-yl-1H-imidazo[4,5-b]pyridin-7-yl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(c3ccnc4nc(C5CNCCO5)[nH]c34)CC2)c(N)c1 |
| InChI | InChI=1S/C23H28N6O2/c1-14-2-3-17(18(24)12-14)23(30)29-9-5-15(6-10-29)16-4-7-26-22-20(16)27-21(28-22)19-13-25-8-11-31-19/h2-4,7,12,15,19,25H,5-6,8-11,13,24H2,1H3,(H,26,27,28) |
| InChIKey | ILADTTWYUYSRLC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|