C18H20ClF2N7O — CID 164921915
2-[[7-chloro-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]ethylcyanamide (PubChem CID 164921915) has the molecular formula C18H20ClF2N7O and a molecular weight of 423.86 g/mol. Its IUPAC name is 2-[[7-chloro-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]ethylcyanamide.
| Compound Name | 2-[[7-chloro-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]ethylcyanamide |
|---|---|
| PubChem CID | 164921915 |
| Molecular Formula | C18H20ClF2N7O |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[[7-chloro-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]ethylcyanamide |
| SMILES | N#CNCCNc1nc(OC[C@@]23CCCN2CC(F)C3)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C18H20ClF2N7O/c19-15-13(21)14-12(7-25-15)16(24-4-3-23-10-22)27-17(26-14)29-9-18-2-1-5-28(18)8-11(20)6-18/h7,11,23H,1-6,8-9H2,(H,24,26,27)/t11?,18-/m0/s1 |
| InChIKey | DZSTUUFESLMTBE-MCEAHNFKSA-N |
| XLogP | 2.26 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|