About 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile
7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile (PubChem CID 164922021) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile.
Molecular Properties
| Compound Name | 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile |
| PubChem CID | 164922021 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile |
| SMILES | CN1CCC2(CC1)CCN2C#N |
| InChI | InChI=1S/C9H15N3/c1-11-5-2-9(3-6-11)4-7-12(9)8-10/h2-7H2,1H3 |
| InChIKey | DXHILVJSWHUXSY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile?
The IUPAC name of 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile (CID 164922021) is 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile.
What is the SMILES notation for 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile?
The canonical SMILES for 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile is CN1CCC2(CC1)CCN2C#N.
What is the InChIKey of 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile?
The InChIKey is DXHILVJSWHUXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-11-5-2-9(3-6-11)4-7-12(9)8-10/h2-7H2,1H3.
What are the key properties of 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile?
7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile has a molecular weight of 165.24 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,7-diazaspiro[3.5]nonane-1-carbonitrile is sourced from PubChem (CID 164922021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).