About ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol
ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol (PubChem CID 164922118) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol.
Molecular Properties
| Compound Name | ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol |
| PubChem CID | 164922118 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol |
| SMILES | CC.CN1CC=CC1CO |
| InChI | InChI=1S/C6H11NO.C2H6/c1-7-4-2-3-6(7)5-8;1-2/h2-3,6,8H,4-5H2,1H3;1-2H3 |
| InChIKey | FJCXEMOYYHJZTH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol?
The IUPAC name of ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol (CID 164922118) is ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol.
What is the SMILES notation for ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol?
The canonical SMILES for ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol is CC.CN1CC=CC1CO.
What is the InChIKey of ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol?
The InChIKey is FJCXEMOYYHJZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C2H6/c1-7-4-2-3-6(7)5-8;1-2/h2-3,6,8H,4-5H2,1H3;1-2H3.
What are the key properties of ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol?
ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol has a molecular weight of 143.23 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1-methyl-2,5-dihydropyrrol-2-yl)methanol is sourced from PubChem (CID 164922118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).