About ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine
ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine (PubChem CID 164922368) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine.
Molecular Properties
| Compound Name | ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine |
| PubChem CID | 164922368 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine |
| SMILES | CC.CC(C)/C=C/C1CCCN1C.COC |
| InChI | InChI=1S/C10H19N.C2H6O.C2H6/c1-9(2)6-7-10-5-4-8-11(10)3;1-3-2;1-2/h6-7,9-10H,4-5,8H2,1-3H3;1-2H3;1-2H3/b7-6+;; |
| InChIKey | QSLIKQIYRVISDL-KMXZHCNGSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine?
The IUPAC name of ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine (CID 164922368) is ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine.
What is the SMILES notation for ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine?
The canonical SMILES for ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine is CC.CC(C)/C=C/C1CCCN1C.COC.
What is the InChIKey of ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine?
The InChIKey is QSLIKQIYRVISDL-KMXZHCNGSA-N. The full InChI is InChI=1S/C10H19N.C2H6O.C2H6/c1-9(2)6-7-10-5-4-8-11(10)3;1-3-2;1-2/h6-7,9-10H,4-5,8H2,1-3H3;1-2H3;1-2H3/b7-6+;;.
What are the key properties of ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine?
ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine has a molecular weight of 229.41 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxymethane;1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine is sourced from PubChem (CID 164922368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).