About (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole
(1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole (PubChem CID 164922492) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole.
Molecular Properties
| Compound Name | (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole |
| PubChem CID | 164922492 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole |
| SMILES | CCN1CCCC1(CC)CO.Cn1cccn1 |
| InChI | InChI=1S/C9H19NO.C4H6N2/c1-3-9(8-11)6-5-7-10(9)4-2;1-6-4-2-3-5-6/h11H,3-8H2,1-2H3;2-4H,1H3 |
| InChIKey | DVKTVXQTWKCJGN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole?
The IUPAC name of (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole (CID 164922492) is (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole.
What is the SMILES notation for (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole?
The canonical SMILES for (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole is CCN1CCCC1(CC)CO.Cn1cccn1.
What is the InChIKey of (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole?
The InChIKey is DVKTVXQTWKCJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C4H6N2/c1-3-9(8-11)6-5-7-10(9)4-2;1-6-4-2-3-5-6/h11H,3-8H2,1-2H3;2-4H,1H3.
What are the key properties of (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole?
(1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole has a molecular weight of 239.36 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-diethylpyrrolidin-2-yl)methanol;1-methylpyrazole is sourced from PubChem (CID 164922492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).