C10H15FINO — CID 164922500
[2-[(E)-2-fluoroethenyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl hypoiodite (PubChem CID 164922500) has the molecular formula C10H15FINO and a molecular weight of 311.14 g/mol. Its IUPAC name is [2-[(E)-2-fluoroethenyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl hypoiodite.
| Compound Name | [2-[(E)-2-fluoroethenyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl hypoiodite |
|---|---|
| PubChem CID | 164922500 |
| Molecular Formula | C10H15FINO |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | [2-[(E)-2-fluoroethenyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl hypoiodite |
| SMILES | F/C=C/C1CN2CCCC2(COI)C1 |
| InChI | InChI=1S/C10H15FINO/c11-4-2-9-6-10(8-14-12)3-1-5-13(10)7-9/h2,4,9H,1,3,5-8H2/b4-2+ |
| InChIKey | IURHCHJJXCRFNV-DUXPYHPUSA-N |
| XLogP | 2.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|