C17H24F2N2 — CID 164923412
2-(3,5-difluorophenyl)-2,10-diazaspiro[5.7]tridecane (PubChem CID 164923412) has the molecular formula C17H24F2N2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-2,10-diazaspiro[5.7]tridecane.
| Compound Name | 2-(3,5-difluorophenyl)-2,10-diazaspiro[5.7]tridecane |
|---|---|
| PubChem CID | 164923412 |
| Molecular Formula | C17H24F2N2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-(3,5-difluorophenyl)-2,10-diazaspiro[5.7]tridecane |
| SMILES | Fc1cc(F)cc(N2CCCC3(CCCNCCC3)C2)c1 |
| InChI | InChI=1S/C17H24F2N2/c18-14-10-15(19)12-16(11-14)21-9-3-6-17(13-21)4-1-7-20-8-2-5-17/h10-12,20H,1-9,13H2 |
| InChIKey | LKEUMKLKUYOUFI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |