C16H22F2N2 — CID 164923739
(2E,3Z)-6-(2,2-difluoropropyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine (PubChem CID 164923739) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2E,3Z)-6-(2,2-difluoropropyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine.
| Compound Name | (2E,3Z)-6-(2,2-difluoropropyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164923739 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2E,3Z)-6-(2,2-difluoropropyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
| SMILES | C=C/C=c1/[nH]c2c(/c1=C/C)CC(C)N(CC(C)(F)F)C2 |
| InChI | InChI=1S/C16H22F2N2/c1-5-7-14-12(6-2)13-8-11(3)20(9-15(13)19-14)10-16(4,17)18/h5-7,11,19H,1,8-10H2,2-4H3/b12-6-,14-7+ |
| InChIKey | DAGJDANKBRSDHI-GQUDHXATSA-N |
| XLogP | 2.18 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |