C15H19F3N2 — CID 164924582
(2E,3Z)-3-ethylidene-5-methyl-2-prop-2-enylidene-6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine (PubChem CID 164924582) has the molecular formula C15H19F3N2 and a molecular weight of 284.32 g/mol. Its IUPAC name is (2E,3Z)-3-ethylidene-5-methyl-2-prop-2-enylidene-6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine.
| Compound Name | (2E,3Z)-3-ethylidene-5-methyl-2-prop-2-enylidene-6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164924582 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (2E,3Z)-3-ethylidene-5-methyl-2-prop-2-enylidene-6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
| SMILES | C=C/C=c1/[nH]c2c(/c1=C/C)CC(C)N(CC(F)(F)F)C2 |
| InChI | InChI=1S/C15H19F3N2/c1-4-6-13-11(5-2)12-7-10(3)20(8-14(12)19-13)9-15(16,17)18/h4-6,10,19H,1,7-9H2,2-3H3/b11-5-,13-6+ |
| InChIKey | RBOTWKCKFPNMRO-FALRLRKYSA-N |
| XLogP | 2.09 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |