C37H50N6O7 — CID 164924804
3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-morpholin-4-ylethyl)benzimidazol-2-yl]ethyl]phenoxy]ethyl]prop-2-enamide (PubChem CID 164924804) has the molecular formula C37H50N6O7 and a molecular weight of 690.84 g/mol. Its IUPAC name is 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-morpholin-4-ylethyl)benzimidazol-2-yl]ethyl]phenoxy]ethyl]prop-2-enamide.
| Compound Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-morpholin-4-ylethyl)benzimidazol-2-yl]ethyl]phenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 164924804 |
| Molecular Formula | C37H50N6O7 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.37 |
| IUPAC Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-morpholin-4-ylethyl)benzimidazol-2-yl]ethyl]phenoxy]ethyl]prop-2-enamide |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)nc(CCc1ccc(OCCNC(=O)C=COCCOCCOCCN)cc1)n2CCN1CCOCC1 |
| InChI | InChI=1S/C37H50N6O7/c1-28-37(29(2)50-41-28)31-6-9-34-33(27-31)40-35(43(34)15-14-42-16-21-47-22-17-42)10-5-30-3-7-32(8-4-30)49-20-13-39-36(44)11-18-45-23-25-48-26-24-46-19-12-38/h3-4,6-9,11,18,27H,5,10,12-17,19-26,38H2,1-2H3,(H,39,44) |
| InChIKey | MXQYDVQCQOSEGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|