C18H18FN7O3S — CID 164925550
5-[3-[6-(benzylamino)-2-fluoropurin-9-yl]propyl]-1,2-oxazole-3-sulfonamide (PubChem CID 164925550) has the molecular formula C18H18FN7O3S and a molecular weight of 431.45 g/mol. Its IUPAC name is 5-[3-[6-(benzylamino)-2-fluoropurin-9-yl]propyl]-1,2-oxazole-3-sulfonamide.
| Compound Name | 5-[3-[6-(benzylamino)-2-fluoropurin-9-yl]propyl]-1,2-oxazole-3-sulfonamide |
|---|---|
| PubChem CID | 164925550 |
| Molecular Formula | C18H18FN7O3S |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 5-[3-[6-(benzylamino)-2-fluoropurin-9-yl]propyl]-1,2-oxazole-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(CCCn2cnc3c(NCc4ccccc4)nc(F)nc32)on1 |
| InChI | InChI=1S/C18H18FN7O3S/c19-18-23-16(21-10-12-5-2-1-3-6-12)15-17(24-18)26(11-22-15)8-4-7-13-9-14(25-29-13)30(20,27)28/h1-3,5-6,9,11H,4,7-8,10H2,(H2,20,27,28)(H,21,23,24) |
| InChIKey | SNPNWEUZBUAXGL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 141.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |