C12H24N4OS — CID 164925715
[4-[(3-amino-2-methylpropyl)amino]-2-methylsulfanylpyrimidin-5-yl]methanol;ethane (PubChem CID 164925715) has the molecular formula C12H24N4OS and a molecular weight of 272.42 g/mol. Its IUPAC name is [4-[(3-amino-2-methylpropyl)amino]-2-methylsulfanylpyrimidin-5-yl]methanol;ethane.
| Compound Name | [4-[(3-amino-2-methylpropyl)amino]-2-methylsulfanylpyrimidin-5-yl]methanol;ethane |
|---|---|
| PubChem CID | 164925715 |
| Molecular Formula | C12H24N4OS |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [4-[(3-amino-2-methylpropyl)amino]-2-methylsulfanylpyrimidin-5-yl]methanol;ethane |
| SMILES | CC.CSc1ncc(CO)c(NCC(C)CN)n1 |
| InChI | InChI=1S/C10H18N4OS.C2H6/c1-7(3-11)4-12-9-8(6-15)5-13-10(14-9)16-2;1-2/h5,7,15H,3-4,6,11H2,1-2H3,(H,12,13,14);1-2H3 |
| InChIKey | XXDSEAYLHULIBJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |