C15H18BN7 — CID 164925744
CID 164925744 (PubChem CID 164925744) has the molecular formula C15H18BN7 and a molecular weight of 307.17 g/mol.
| Compound Name | CID 164925744 |
|---|---|
| PubChem CID | 164925744 |
| Molecular Formula | C15H18BN7 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | — |
| SMILES | [B]c1c([C@@H]2CCCNC2)nc2c(-c3cnn(C)c3)cnn2c1N |
| InChI | InChI=1S/C15H18BN7/c1-22-8-10(6-19-22)11-7-20-23-14(17)12(16)13(21-15(11)23)9-3-2-4-18-5-9/h6-9,18H,2-5,17H2,1H3/t9-/m1/s1 |
| InChIKey | BZJXRKMAWZIBMV-SECBINFHSA-N |
| XLogP | -0.03 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|