About tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate
tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate (PubChem CID 164925898) has the molecular formula C12H22N4O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate |
| PubChem CID | 164925898 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc(CCOCCCN)n1 |
| InChI | InChI=1S/C12H22N4O3/c1-12(2,3)19-11(17)16-9-14-10(15-16)5-8-18-7-4-6-13/h9H,4-8,13H2,1-3H3 |
| InChIKey | VLHYOOHHKXBBSF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate?
The IUPAC name of tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate (CID 164925898) is tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate?
The canonical SMILES for tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate is CC(C)(C)OC(=O)n1cnc(CCOCCCN)n1.
What is the InChIKey of tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate?
The InChIKey is VLHYOOHHKXBBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O3/c1-12(2,3)19-11(17)16-9-14-10(15-16)5-8-18-7-4-6-13/h9H,4-8,13H2,1-3H3.
What are the key properties of tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate?
tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate has a molecular weight of 270.33 g/mol, XLogP of 0.97, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-(3-aminopropoxy)ethyl]-1,2,4-triazole-1-carboxylate is sourced from PubChem (CID 164925898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).