C31H40N6O3 — CID 164926413
tert-butyl N-[5-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-5-oxopentyl]carbamate (PubChem CID 164926413) has the molecular formula C31H40N6O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 164926413 |
| Molecular Formula | C31H40N6O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | tert-butyl N-[5-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-5-oxopentyl]carbamate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(NC(=O)CCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40N6O3/c1-5-6-13-25-36-27-28(23-11-7-8-12-24(23)35-29(27)32)37(25)20-21-15-17-22(18-16-21)34-26(38)14-9-10-19-33-30(39)40-31(2,3)4/h7-8,11-12,15-18H,5-6,9-10,13-14,19-20H2,1-4H3,(H2,32,35)(H,33,39)(H,34,38) |
| InChIKey | FPEFGJHJCNWONC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|