C32H42N6O3 — CID 164926449
tert-butyl N-[6-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-6-oxohexyl]carbamate (PubChem CID 164926449) has the molecular formula C32H42N6O3 and a molecular weight of 558.73 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 164926449 |
| Molecular Formula | C32H42N6O3 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | tert-butyl N-[6-[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]anilino]-6-oxohexyl]carbamate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(NC(=O)CCCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H42N6O3/c1-5-6-14-26-37-28-29(24-12-9-10-13-25(24)36-30(28)33)38(26)21-22-16-18-23(19-17-22)35-27(39)15-8-7-11-20-34-31(40)41-32(2,3)4/h9-10,12-13,16-19H,5-8,11,14-15,20-21H2,1-4H3,(H2,33,36)(H,34,40)(H,35,39) |
| InChIKey | FQEMAEUGQCAUOK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|