C15H27N3 — CID 164926896
ethane;1-(6-ethyl-2-pyridinyl)-N-methylpiperidin-3-amine (PubChem CID 164926896) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;1-(6-ethyl-2-pyridinyl)-N-methylpiperidin-3-amine.
| Compound Name | ethane;1-(6-ethyl-2-pyridinyl)-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 164926896 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | ethane;1-(6-ethyl-2-pyridinyl)-N-methylpiperidin-3-amine |
| SMILES | CC.CCc1cccc(N2CCCC(NC)C2)n1 |
| InChI | InChI=1S/C13H21N3.C2H6/c1-3-11-6-4-8-13(15-11)16-9-5-7-12(10-16)14-2;1-2/h4,6,8,12,14H,3,5,7,9-10H2,1-2H3;1-2H3 |
| InChIKey | BEKXHGQRGVNNKP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |