About molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine
molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine (PubChem CID 164926953) has the molecular formula C15H25F3N2O
and a molecular weight of 306.37 g/mol. Its IUPAC name is molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine.
Molecular Properties
| Compound Name | molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine |
| PubChem CID | 164926953 |
| Molecular Formula | C15H25F3N2O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine |
| SMILES | C1CCOC1.CC(C)c1cccc(CNCC(F)(F)F)n1.[H][H] |
| InChI | InChI=1S/C11H15F3N2.C4H8O.H2/c1-8(2)10-5-3-4-9(16-10)6-15-7-11(12,13)14;1-2-4-5-3-1;/h3-5,8,15H,6-7H2,1-2H3;1-4H2;1H |
| InChIKey | KBZOEFSSEGLJFY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine?
The IUPAC name of molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine (CID 164926953) is molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine.
What is the SMILES notation for molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine?
The canonical SMILES for molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine is C1CCOC1.CC(C)c1cccc(CNCC(F)(F)F)n1.[H][H].
What is the InChIKey of molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine?
The InChIKey is KBZOEFSSEGLJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N2.C4H8O.H2/c1-8(2)10-5-3-4-9(16-10)6-15-7-11(12,13)14;1-2-4-5-3-1;/h3-5,8,15H,6-7H2,1-2H3;1-4H2;1H.
What are the key properties of molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine?
molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine has a molecular weight of 306.37 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;oxolane;2,2,2-trifluoro-N-[(6-propan-2-yl-2-pyridinyl)methyl]ethanamine is sourced from PubChem (CID 164926953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).