About 2-imino-N,N,3-trimethylbut-3-en-1-amine
2-imino-N,N,3-trimethylbut-3-en-1-amine (PubChem CID 164927115) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-imino-N,N,3-trimethylbut-3-en-1-amine.
Molecular Properties
| Compound Name | 2-imino-N,N,3-trimethylbut-3-en-1-amine |
| PubChem CID | 164927115 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-imino-N,N,3-trimethylbut-3-en-1-amine |
| SMILES | [H]/N=C(\CN(C)C)C(=C)C |
| InChI | InChI=1S/C7H14N2/c1-6(2)7(8)5-9(3)4/h8H,1,5H2,2-4H3/b8-7+ |
| InChIKey | HYVGMYYRPTVUKO-BQYQJAHWSA-N |
| XLogP | 1.14 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-N,N,3-trimethylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-N,N,3-trimethylbut-3-en-1-amine?
The IUPAC name of 2-imino-N,N,3-trimethylbut-3-en-1-amine (CID 164927115) is 2-imino-N,N,3-trimethylbut-3-en-1-amine.
What is the SMILES notation for 2-imino-N,N,3-trimethylbut-3-en-1-amine?
The canonical SMILES for 2-imino-N,N,3-trimethylbut-3-en-1-amine is [H]/N=C(\CN(C)C)C(=C)C.
What is the InChIKey of 2-imino-N,N,3-trimethylbut-3-en-1-amine?
The InChIKey is HYVGMYYRPTVUKO-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H14N2/c1-6(2)7(8)5-9(3)4/h8H,1,5H2,2-4H3/b8-7+.
What are the key properties of 2-imino-N,N,3-trimethylbut-3-en-1-amine?
2-imino-N,N,3-trimethylbut-3-en-1-amine has a molecular weight of 126.20 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-N,N,3-trimethylbut-3-en-1-amine is sourced from PubChem (CID 164927115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).