About 3-butoxy-2,6-bis(chloromethyl)pyridine
3-butoxy-2,6-bis(chloromethyl)pyridine (PubChem CID 164927153) has the molecular formula C11H15Cl2NO
and a molecular weight of 248.15 g/mol. Its IUPAC name is 3-butoxy-2,6-bis(chloromethyl)pyridine.
Molecular Properties
| Compound Name | 3-butoxy-2,6-bis(chloromethyl)pyridine |
| PubChem CID | 164927153 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 3-butoxy-2,6-bis(chloromethyl)pyridine |
| SMILES | CCCCOc1ccc(CCl)nc1CCl |
| InChI | InChI=1S/C11H15Cl2NO/c1-2-3-6-15-11-5-4-9(7-12)14-10(11)8-13/h4-5H,2-3,6-8H2,1H3 |
| InChIKey | QULQSGAYSOJDCI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-2,6-bis(chloromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-2,6-bis(chloromethyl)pyridine?
The IUPAC name of 3-butoxy-2,6-bis(chloromethyl)pyridine (CID 164927153) is 3-butoxy-2,6-bis(chloromethyl)pyridine.
What is the SMILES notation for 3-butoxy-2,6-bis(chloromethyl)pyridine?
The canonical SMILES for 3-butoxy-2,6-bis(chloromethyl)pyridine is CCCCOc1ccc(CCl)nc1CCl.
What is the InChIKey of 3-butoxy-2,6-bis(chloromethyl)pyridine?
The InChIKey is QULQSGAYSOJDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2NO/c1-2-3-6-15-11-5-4-9(7-12)14-10(11)8-13/h4-5H,2-3,6-8H2,1H3.
What are the key properties of 3-butoxy-2,6-bis(chloromethyl)pyridine?
3-butoxy-2,6-bis(chloromethyl)pyridine has a molecular weight of 248.15 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-2,6-bis(chloromethyl)pyridine is sourced from PubChem (CID 164927153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).