C52H30N6O — CID 164927450
2,4,5-trideuterio-3-[4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-6-(5-phenylindolo[3,2-c]carbazol-12-yl)benzonitrile (PubChem CID 164927450) has the molecular formula C52H30N6O and a molecular weight of 762.90 g/mol. Its IUPAC name is 2,4,5-trideuterio-3-[4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-6-(5-phenylindolo[3,2-c]carbazol-12-yl)benzonitrile.
| Compound Name | 2,4,5-trideuterio-3-[4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-6-(5-phenylindolo[3,2-c]carbazol-12-yl)benzonitrile |
|---|---|
| PubChem CID | 164927450 |
| Molecular Formula | C52H30N6O |
| Molecular Weight | 762.90 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | 2,4,5-trideuterio-3-[4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-6-(5-phenylindolo[3,2-c]carbazol-12-yl)benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3c([2H])c([2H])c(-n4c5ccccc5c5ccc6c(c7ccccc7n6-c6ccccc6)c54)c(C#N)c3[2H])nc(-c3cccc4c3oc3ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C52H30N6O/c53-31-34-30-33(51-54-50(32-14-3-1-4-15-32)55-52(56-51)41-22-13-21-39-37-19-9-12-25-46(37)59-49(39)41)26-28-42(34)58-43-23-10-7-18-36(43)38-27-29-45-47(48(38)58)40-20-8-11-24-44(40)57(45)35-16-5-2-6-17-35/h1-30H/i1D,3D,4D,14D,15D,26D,28D,30D |
| InChIKey | UROOBVKBNJLYBF-WUKUVUFLSA-N |
| XLogP | 12.84 |
| TPSA | 85.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.90 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |