C42H48IrN3- — CID 164927689
3-tert-butyl-4-(4-tert-butyl-2-methylphenyl)-5-[3-(9-hexylfluoren-9-yl)benzene-6-id-1-yl]-1,2,4-triazole;iridium (PubChem CID 164927689) has the molecular formula C42H48IrN3- and a molecular weight of 787.08 g/mol. Its IUPAC name is 3-tert-butyl-4-(4-tert-butyl-2-methylphenyl)-5-[3-(9-hexylfluoren-9-yl)benzene-6-id-1-yl]-1,2,4-triazole;iridium.
| Compound Name | 3-tert-butyl-4-(4-tert-butyl-2-methylphenyl)-5-[3-(9-hexylfluoren-9-yl)benzene-6-id-1-yl]-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 164927689 |
| Molecular Formula | C42H48IrN3- |
| Molecular Weight | 787.08 g/mol |
| Exact Mass | 787.35 |
| IUPAC Name | 3-tert-butyl-4-(4-tert-butyl-2-methylphenyl)-5-[3-(9-hexylfluoren-9-yl)benzene-6-id-1-yl]-1,2,4-triazole;iridium |
| SMILES | CCCCCCC1(c2cc[c-]c(-c3nnc(C(C)(C)C)n3-c3ccc(C(C)(C)C)cc3C)c2)c2ccccc2-c2ccccc21.[Ir] |
| InChI | InChI=1S/C42H48N3.Ir/c1-9-10-11-16-26-42(35-22-14-12-20-33(35)34-21-13-15-23-36(34)42)32-19-17-18-30(28-32)38-43-44-39(41(6,7)8)45(38)37-25-24-31(27-29(37)2)40(3,4)5;/h12-15,17,19-25,27-28H,9-11,16,26H2,1-8H3;/q-1; |
| InChIKey | MIBSYEPNWJUONC-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.08 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|