C22H25FO5 — CID 164929060
[(2S,3R,4R,5S,6S)-2-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 164929060) has the molecular formula C22H25FO5 and a molecular weight of 388.44 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-2-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6S)-2-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 164929060 |
| Molecular Formula | C22H25FO5 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-2-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](C)O[C@H]1F |
| InChI | InChI=1S/C22H25FO5/c1-15-19(25-13-17-9-5-3-6-10-17)20(21(22(23)27-15)28-16(2)24)26-14-18-11-7-4-8-12-18/h3-12,15,19-22H,13-14H2,1-2H3/t15-,19-,20+,21+,22+/m0/s1 |
| InChIKey | DNUHNJNYWLZSSH-AAZWCJRRSA-N |
| XLogP | 3.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |