C18H22F3NO3 — CID 164929613
ethyl 2-ethyl-4-oxo-4-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]butanoate (PubChem CID 164929613) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is ethyl 2-ethyl-4-oxo-4-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]butanoate.
| Compound Name | ethyl 2-ethyl-4-oxo-4-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]butanoate |
|---|---|
| PubChem CID | 164929613 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethyl 2-ethyl-4-oxo-4-[(4R)-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]butanoate |
| SMILES | CCOC(=O)C(CC)CC(=O)C1C[C@H](c2c(F)ccc(F)c2F)CN1 |
| InChI | InChI=1S/C18H22F3NO3/c1-3-10(18(24)25-4-2)8-15(23)14-7-11(9-22-14)16-12(19)5-6-13(20)17(16)21/h5-6,10-11,14,22H,3-4,7-9H2,1-2H3/t10?,11-,14?/m0/s1 |
| InChIKey | FDHGYEVAVIIZFX-CVZZAPKMSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|