C36H22BNS — CID 164930479
11,23-bis(2,3,4,5,6-pentadeuteriophenyl)-20-thia-11-aza-1-boraheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2,4(12),5,7,9,13,15(27),16,18,21(26),22,24-dodecaene (PubChem CID 164930479) has the molecular formula C36H22BNS and a molecular weight of 521.52 g/mol. Its IUPAC name is 11,23-bis(2,3,4,5,6-pentadeuteriophenyl)-20-thia-11-aza-1-boraheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2,4(12),5,7,9,13,15(27),16,18,21(26),22,24-dodecaene.
| Compound Name | 11,23-bis(2,3,4,5,6-pentadeuteriophenyl)-20-thia-11-aza-1-boraheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2,4(12),5,7,9,13,15(27),16,18,21(26),22,24-dodecaene |
|---|---|
| PubChem CID | 164930479 |
| Molecular Formula | C36H22BNS |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 11,23-bis(2,3,4,5,6-pentadeuteriophenyl)-20-thia-11-aza-1-boraheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2,4(12),5,7,9,13,15(27),16,18,21(26),22,24-dodecaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)Sc2cccc4c2B3c2cc3c5ccccc5n(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c3cc2-4)c([2H])c1[2H] |
| InChI | InChI=1S/C36H22BNS/c1-3-10-23(11-4-1)24-18-19-30-35(20-24)39-34-17-9-15-27-28-22-33-29(21-31(28)37(30)36(27)34)26-14-7-8-16-32(26)38(33)25-12-5-2-6-13-25/h1-22H/i1D,2D,3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | YAMMEKOYHCVCHD-KJIKOLQBSA-N |
| XLogP | 7.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|